C25H33N3O4S — CID 154834956
N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 154834956) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 154834956 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(C(=O)NC3CCCc4[nH]c(=O)ccc43)CC2)c1C |
| InChI | InChI=1S/C25H33N3O4S/c1-15-14-16(2)18(4)24(17(15)3)33(31,32)28-12-10-19(11-13-28)25(30)27-22-7-5-6-21-20(22)8-9-23(29)26-21/h8-9,14,19,22H,5-7,10-13H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | OPDCHNVARKMIHH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |