C21H23N5O2 — CID 154844621
6-ethyl-N-[3-(3-methyl-1,2,4-triazol-4-yl)phenyl]-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 154844621) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 6-ethyl-N-[3-(3-methyl-1,2,4-triazol-4-yl)phenyl]-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | 6-ethyl-N-[3-(3-methyl-1,2,4-triazol-4-yl)phenyl]-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 154844621 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 6-ethyl-N-[3-(3-methyl-1,2,4-triazol-4-yl)phenyl]-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | CCC1CCc2[nH]c(=O)c(C(=O)Nc3cccc(-n4cnnc4C)c3)cc2C1 |
| InChI | InChI=1S/C21H23N5O2/c1-3-14-7-8-19-15(9-14)10-18(21(28)24-19)20(27)23-16-5-4-6-17(11-16)26-12-22-25-13(26)2/h4-6,10-12,14H,3,7-9H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | RWWOSSHBACDWDH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |