C8H14N4O4S — CID 154849339
1-(3-hydroxypropyl)-3-(1-methylimidazol-2-yl)sulfonylurea (PubChem CID 154849339) has the molecular formula C8H14N4O4S and a molecular weight of 262.29 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-(1-methylimidazol-2-yl)sulfonylurea.
| Compound Name | 1-(3-hydroxypropyl)-3-(1-methylimidazol-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 154849339 |
| Molecular Formula | C8H14N4O4S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-(1-methylimidazol-2-yl)sulfonylurea |
| SMILES | Cn1ccnc1S(=O)(=O)NC(=O)NCCCO |
| InChI | InChI=1S/C8H14N4O4S/c1-12-5-4-10-8(12)17(15,16)11-7(14)9-3-2-6-13/h4-5,13H,2-3,6H2,1H3,(H2,9,11,14) |
| InChIKey | ACLAESQLKCRNBA-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|