C13H20N2O4S — CID 154858067
N-(2-methylcyclohexyl)-5-(methylsulfamoyl)furan-3-carboxamide (PubChem CID 154858067) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-5-(methylsulfamoyl)furan-3-carboxamide.
| Compound Name | N-(2-methylcyclohexyl)-5-(methylsulfamoyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 154858067 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(2-methylcyclohexyl)-5-(methylsulfamoyl)furan-3-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NC2CCCCC2C)co1 |
| InChI | InChI=1S/C13H20N2O4S/c1-9-5-3-4-6-11(9)15-13(16)10-7-12(19-8-10)20(17,18)14-2/h7-9,11,14H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | GPVDIZUWRKSBOJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |