C24H14F2N4O3 — CID 154864222
2,7-difluoro-9-oxo-N-(3-pyridazin-3-yloxyphenyl)-10H-acridine-4-carboxamide (PubChem CID 154864222) has the molecular formula C24H14F2N4O3 and a molecular weight of 444.40 g/mol. Its IUPAC name is 2,7-difluoro-9-oxo-N-(3-pyridazin-3-yloxyphenyl)-10H-acridine-4-carboxamide.
| Compound Name | 2,7-difluoro-9-oxo-N-(3-pyridazin-3-yloxyphenyl)-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 154864222 |
| Molecular Formula | C24H14F2N4O3 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2,7-difluoro-9-oxo-N-(3-pyridazin-3-yloxyphenyl)-10H-acridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2cccnn2)c1)c1cc(F)cc2c(=O)c3cc(F)ccc3[nH]c12 |
| InChI | InChI=1S/C24H14F2N4O3/c25-13-6-7-20-17(9-13)23(31)18-10-14(26)11-19(22(18)29-20)24(32)28-15-3-1-4-16(12-15)33-21-5-2-8-27-30-21/h1-12H,(H,28,32)(H,29,31) |
| InChIKey | MFQAJUMPFMJNGO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|