C14H21NO2S — CID 154865722
2-(2-cyclobutylethylsulfanylmethyl)-3,4-dimethoxypyridine (PubChem CID 154865722) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-(2-cyclobutylethylsulfanylmethyl)-3,4-dimethoxypyridine.
| Compound Name | 2-(2-cyclobutylethylsulfanylmethyl)-3,4-dimethoxypyridine |
|---|---|
| PubChem CID | 154865722 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-(2-cyclobutylethylsulfanylmethyl)-3,4-dimethoxypyridine |
| SMILES | COc1ccnc(CSCCC2CCC2)c1OC |
| InChI | InChI=1S/C14H21NO2S/c1-16-13-6-8-15-12(14(13)17-2)10-18-9-7-11-4-3-5-11/h6,8,11H,3-5,7,9-10H2,1-2H3 |
| InChIKey | OJLKULBMGZNOSZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|