C15H22N2O4 — CID 154867647
(1R,5R)-N-[2-(2-oxopyrrolidin-1-yl)ethoxy]spiro[3-oxabicyclo[3.1.0]hexane-2,1'-cyclobutane]-1-carboxamide (PubChem CID 154867647) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is (1R,5R)-N-[2-(2-oxopyrrolidin-1-yl)ethoxy]spiro[3-oxabicyclo[3.1.0]hexane-2,1'-cyclobutane]-1-carboxamide.
| Compound Name | (1R,5R)-N-[2-(2-oxopyrrolidin-1-yl)ethoxy]spiro[3-oxabicyclo[3.1.0]hexane-2,1'-cyclobutane]-1-carboxamide |
|---|---|
| PubChem CID | 154867647 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1R,5R)-N-[2-(2-oxopyrrolidin-1-yl)ethoxy]spiro[3-oxabicyclo[3.1.0]hexane-2,1'-cyclobutane]-1-carboxamide |
| SMILES | O=C1CCCN1CCONC(=O)[C@]12C[C@H]1COC21CCC1 |
| InChI | InChI=1S/C15H22N2O4/c18-12-3-1-6-17(12)7-8-21-16-13(19)15-9-11(15)10-20-14(15)4-2-5-14/h11H,1-10H2,(H,16,19)/t11-,15-/m0/s1 |
| InChIKey | MTSYBECGWPKZBW-NHYWBVRUSA-N |
| XLogP | 0.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|