C21H26N4O2 — CID 154875571
1-tert-butyl-5-methyl-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]pyrazole-3-carboxamide (PubChem CID 154875571) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-tert-butyl-5-methyl-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]pyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-5-methyl-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 154875571 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-tert-butyl-5-methyl-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]pyrazole-3-carboxamide |
| SMILES | C=CC(=O)N[C@@H]1c2ccccc2C[C@H]1NC(=O)c1cc(C)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C21H26N4O2/c1-6-18(26)23-19-15-10-8-7-9-14(15)12-16(19)22-20(27)17-11-13(2)25(24-17)21(3,4)5/h6-11,16,19H,1,12H2,2-5H3,(H,22,27)(H,23,26)/t16-,19-/m1/s1 |
| InChIKey | FSAIVPSPSJZPBS-VQIMIIECSA-N |
| XLogP | 2.64 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|