C22H18N2O4 — CID 154870964
4-oxo-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]chromene-2-carboxamide (PubChem CID 154870964) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-oxo-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]chromene-2-carboxamide.
| Compound Name | 4-oxo-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]chromene-2-carboxamide |
|---|---|
| PubChem CID | 154870964 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-oxo-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]chromene-2-carboxamide |
| SMILES | C=CC(=O)N[C@@H]1c2ccccc2C[C@H]1NC(=O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C22H18N2O4/c1-2-20(26)24-21-14-8-4-3-7-13(14)11-16(21)23-22(27)19-12-17(25)15-9-5-6-10-18(15)28-19/h2-10,12,16,21H,1,11H2,(H,23,27)(H,24,26)/t16-,21-/m1/s1 |
| InChIKey | SIXHIISGZWBNOB-IIBYNOLFSA-N |
| XLogP | 2.49 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|