C18H16F2N4S — CID 154877837
3-(3,5-difluorophenyl)-N-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 154877837) has the molecular formula C18H16F2N4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-N-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(3,5-difluorophenyl)-N-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 154877837 |
| Molecular Formula | C18H16F2N4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-(3,5-difluorophenyl)-N-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | Fc1cc(F)cc(-c2nsc(NCc3ccc4c(n3)CCCC4)n2)c1 |
| InChI | InChI=1S/C18H16F2N4S/c19-13-7-12(8-14(20)9-13)17-23-18(25-24-17)21-10-15-6-5-11-3-1-2-4-16(11)22-15/h5-9H,1-4,10H2,(H,21,23,24) |
| InChIKey | WMUIGRKNUTVCDK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |