C18H18ClN5 — CID 154878532
3-chloro-N-(1-pyrimidin-2-ylpiperidin-3-yl)isoquinolin-1-amine (PubChem CID 154878532) has the molecular formula C18H18ClN5 and a molecular weight of 339.83 g/mol. Its IUPAC name is 3-chloro-N-(1-pyrimidin-2-ylpiperidin-3-yl)isoquinolin-1-amine.
| Compound Name | 3-chloro-N-(1-pyrimidin-2-ylpiperidin-3-yl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 154878532 |
| Molecular Formula | C18H18ClN5 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-chloro-N-(1-pyrimidin-2-ylpiperidin-3-yl)isoquinolin-1-amine |
| SMILES | Clc1cc2ccccc2c(NC2CCCN(c3ncccn3)C2)n1 |
| InChI | InChI=1S/C18H18ClN5/c19-16-11-13-5-1-2-7-15(13)17(23-16)22-14-6-3-10-24(12-14)18-20-8-4-9-21-18/h1-2,4-5,7-9,11,14H,3,6,10,12H2,(H,22,23) |
| InChIKey | MHRRDOKWDMQQLJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|