C22H28N4OS — CID 154883654
5-[[4-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]thiophene-2-carbonitrile (PubChem CID 154883654) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is 5-[[4-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[[4-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 154883654 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 5-[[4-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]thiophene-2-carbonitrile |
| SMILES | COc1ccccc1N1CCN(C2CCN(Cc3ccc(C#N)s3)CC2)CC1 |
| InChI | InChI=1S/C22H28N4OS/c1-27-22-5-3-2-4-21(22)26-14-12-25(13-15-26)18-8-10-24(11-9-18)17-20-7-6-19(16-23)28-20/h2-7,18H,8-15,17H2,1H3 |
| InChIKey | VRRYQAHIACBWPF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |