C11H14ClF3N2O3S — CID 154907563
2,4,5-trifluoro-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzenesulfonamide;hydrochloride (PubChem CID 154907563) has the molecular formula C11H14ClF3N2O3S and a molecular weight of 346.76 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzenesulfonamide;hydrochloride.
| Compound Name | 2,4,5-trifluoro-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 154907563 |
| Molecular Formula | C11H14ClF3N2O3S |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2,4,5-trifluoro-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(N[C@@H]1CCNC[C@H]1O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H13F3N2O3S.ClH/c12-6-3-8(14)11(4-7(6)13)20(18,19)16-9-1-2-15-5-10(9)17;/h3-4,9-10,15-17H,1-2,5H2;1H/t9-,10-;/m1./s1 |
| InChIKey | CBYCEHPUSXAKBO-DHTOPLTISA-N |
| XLogP | 0.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|