C17H25F3N2O3 — CID 154913500
2-[ethyl(methyl)amino]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]butanamide;formic acid (PubChem CID 154913500) has the molecular formula C17H25F3N2O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[ethyl(methyl)amino]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]butanamide;formic acid.
| Compound Name | 2-[ethyl(methyl)amino]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]butanamide;formic acid |
|---|---|
| PubChem CID | 154913500 |
| Molecular Formula | C17H25F3N2O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[ethyl(methyl)amino]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]butanamide;formic acid |
| SMILES | CCC(C(=O)NCCc1cccc(C(F)(F)F)c1)N(C)CC.O=CO |
| InChI | InChI=1S/C16H23F3N2O.CH2O2/c1-4-14(21(3)5-2)15(22)20-10-9-12-7-6-8-13(11-12)16(17,18)19;2-1-3/h6-8,11,14H,4-5,9-10H2,1-3H3,(H,20,22);1H,(H,2,3) |
| InChIKey | PSNSZXCLFVVIOX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|