C12H21N3O6S2 — CID 154920970
2-(1,1-dioxothiolan-3-yl)-N-[2-(1H-imidazol-5-yl)ethyl]ethanesulfonamide;formic acid (PubChem CID 154920970) has the molecular formula C12H21N3O6S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-[2-(1H-imidazol-5-yl)ethyl]ethanesulfonamide;formic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-[2-(1H-imidazol-5-yl)ethyl]ethanesulfonamide;formic acid |
|---|---|
| PubChem CID | 154920970 |
| Molecular Formula | C12H21N3O6S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-[2-(1H-imidazol-5-yl)ethyl]ethanesulfonamide;formic acid |
| SMILES | O=CO.O=S1(=O)CCC(CCS(=O)(=O)NCCc2cnc[nH]2)C1 |
| InChI | InChI=1S/C11H19N3O4S2.CH2O2/c15-19(16)5-2-10(8-19)3-6-20(17,18)14-4-1-11-7-12-9-13-11;2-1-3/h7,9-10,14H,1-6,8H2,(H,12,13);1H,(H,2,3) |
| InChIKey | GBXNRSBRXMQNHR-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|