C10H22Cl2N2O — CID 154922217
(3S,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride (PubChem CID 154922217) has the molecular formula C10H22Cl2N2O and a molecular weight of 257.20 g/mol. Its IUPAC name is (3S,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride.
| Compound Name | (3S,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride |
|---|---|
| PubChem CID | 154922217 |
| Molecular Formula | C10H22Cl2N2O |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (3S,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride |
| SMILES | CC(C)[C@H]1CN2C[C@H](N)C[C@H]2CO1.Cl.Cl |
| InChI | InChI=1S/C10H20N2O.2ClH/c1-7(2)10-5-12-4-8(11)3-9(12)6-13-10;;/h7-10H,3-6,11H2,1-2H3;2*1H/t8-,9+,10-;;/m1../s1 |
| InChIKey | VAQQNNYAKGAFRD-FNNANFCNSA-N |
| XLogP | 1.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |