C10H20Cl2N2O — CID 154919965
(3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride (PubChem CID 154919965) has the molecular formula C10H20Cl2N2O and a molecular weight of 255.19 g/mol. Its IUPAC name is (3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride.
| Compound Name | (3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride |
|---|---|
| PubChem CID | 154919965 |
| Molecular Formula | C10H20Cl2N2O |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1C[C@H]2CO[C@H](C3CC3)CN2C1 |
| InChI | InChI=1S/C10H18N2O.2ClH/c11-8-3-9-6-13-10(7-1-2-7)5-12(9)4-8;;/h7-10H,1-6,11H2;2*1H/t8-,9+,10+;;/m1../s1 |
| InChIKey | IXIHDLIWWWTYHG-YDMPKLSESA-N |
| XLogP | 1.04 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |