C21H30ClN3O — CID 155500221
(3S,7S,8aS)-N-[1-(2-chlorophenyl)piperidin-4-yl]-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine (PubChem CID 155500221) has the molecular formula C21H30ClN3O and a molecular weight of 375.94 g/mol. Its IUPAC name is (3S,7S,8aS)-N-[1-(2-chlorophenyl)piperidin-4-yl]-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine.
| Compound Name | (3S,7S,8aS)-N-[1-(2-chlorophenyl)piperidin-4-yl]-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 155500221 |
| Molecular Formula | C21H30ClN3O |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (3S,7S,8aS)-N-[1-(2-chlorophenyl)piperidin-4-yl]-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
| SMILES | Clc1ccccc1N1CCC(N[C@H]2C[C@H]3CO[C@@H](C4CC4)CN3C2)CC1 |
| InChI | InChI=1S/C21H30ClN3O/c22-19-3-1-2-4-20(19)24-9-7-16(8-10-24)23-17-11-18-14-26-21(15-5-6-15)13-25(18)12-17/h1-4,15-18,21,23H,5-14H2/t17-,18-,21+/m0/s1 |
| InChIKey | VNSQUELFDCIXNM-BBTUJRGHSA-N |
| XLogP | 3.15 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |