C20H19N3O4 — CID 154931959
5-[[4-[(2-hydroxy-5-methylphenyl)methyl-methylamino]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 154931959) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 5-[[4-[(2-hydroxy-5-methylphenyl)methyl-methylamino]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-[(2-hydroxy-5-methylphenyl)methyl-methylamino]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 154931959 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 5-[[4-[(2-hydroxy-5-methylphenyl)methyl-methylamino]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(O)c(CN(C)c2ccc(C=C3C(=O)NC(=O)NC3=O)cc2)c1 |
| InChI | InChI=1S/C20H19N3O4/c1-12-3-8-17(24)14(9-12)11-23(2)15-6-4-13(5-7-15)10-16-18(25)21-20(27)22-19(16)26/h3-10,24H,11H2,1-2H3,(H2,21,22,25,26,27) |
| InChIKey | OYEOJDQONREFKL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|