C13H20N2O2 — CID 154942376
4-amino-5-(4-amino-3,5-dideuteriophenyl)-2,2-dimethylpentanoic acid (PubChem CID 154942376) has the molecular formula C13H20N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-amino-5-(4-amino-3,5-dideuteriophenyl)-2,2-dimethylpentanoic acid.
| Compound Name | 4-amino-5-(4-amino-3,5-dideuteriophenyl)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 154942376 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 4-amino-5-(4-amino-3,5-dideuteriophenyl)-2,2-dimethylpentanoic acid |
| SMILES | [2H]c1cc(CC(N)CC(C)(C)C(=O)O)cc([2H])c1N |
| InChI | InChI=1S/C13H20N2O2/c1-13(2,12(16)17)8-11(15)7-9-3-5-10(14)6-4-9/h3-6,11H,7-8,14-15H2,1-2H3,(H,16,17)/i5D,6D |
| InChIKey | XZAMYZBUQQFHPF-KCZCTXNHSA-N |
| XLogP | 1.64 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|