C17H18ClNO2 — CID 154954437
15-chloro-10-ethyl-4-methoxy-9-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,4,6,13,15-hexaene (PubChem CID 154954437) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is 15-chloro-10-ethyl-4-methoxy-9-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,4,6,13,15-hexaene.
| Compound Name | 15-chloro-10-ethyl-4-methoxy-9-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 154954437 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 15-chloro-10-ethyl-4-methoxy-9-oxa-5-azatricyclo[10.4.0.02,7]hexadeca-1(12),2,4,6,13,15-hexaene |
| SMILES | CCC1Cc2ccc(Cl)cc2-c2cc(OC)ncc2CO1 |
| InChI | InChI=1S/C17H18ClNO2/c1-3-14-6-11-4-5-13(18)7-15(11)16-8-17(20-2)19-9-12(16)10-21-14/h4-5,7-9,14H,3,6,10H2,1-2H3 |
| InChIKey | CQKBURLFVYBRAP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |