C35H47N5O7 — CID 154957802
(3S)-3-[[4-[3-(6-aminohexanoylamino)propoxy]benzoyl]amino]-4-[4-[3-[(4-methoxy-2-pyridinyl)amino]propoxy]phenyl]butanoic acid (PubChem CID 154957802) has the molecular formula C35H47N5O7 and a molecular weight of 649.79 g/mol. Its IUPAC name is (3S)-3-[[4-[3-(6-aminohexanoylamino)propoxy]benzoyl]amino]-4-[4-[3-[(4-methoxy-2-pyridinyl)amino]propoxy]phenyl]butanoic acid.
| Compound Name | (3S)-3-[[4-[3-(6-aminohexanoylamino)propoxy]benzoyl]amino]-4-[4-[3-[(4-methoxy-2-pyridinyl)amino]propoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 154957802 |
| Molecular Formula | C35H47N5O7 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.35 |
| IUPAC Name | (3S)-3-[[4-[3-(6-aminohexanoylamino)propoxy]benzoyl]amino]-4-[4-[3-[(4-methoxy-2-pyridinyl)amino]propoxy]phenyl]butanoic acid |
| SMILES | COc1ccnc(NCCCOc2ccc(C[C@@H](CC(=O)O)NC(=O)c3ccc(OCCCNC(=O)CCCCCN)cc3)cc2)c1 |
| InChI | InChI=1S/C35H47N5O7/c1-45-31-16-20-38-32(25-31)37-18-5-21-46-29-12-8-26(9-13-29)23-28(24-34(42)43)40-35(44)27-10-14-30(15-11-27)47-22-6-19-39-33(41)7-3-2-4-17-36/h8-16,20,25,28H,2-7,17-19,21-24,36H2,1H3,(H,37,38)(H,39,41)(H,40,44)(H,42,43)/t28-/m0/s1 |
| InChIKey | IAUHPJYVZIBVGD-NDEPHWFRSA-N |
| XLogP | 4.19 |
| TPSA | 174.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|