About N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide
N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide (PubChem CID 154964280) has the molecular formula C16H20N2O4
and a molecular weight of 304.35 g/mol. Its IUPAC name is N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide.
Molecular Properties
| Compound Name | N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide |
| PubChem CID | 154964280 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide |
| SMILES | C#CC(=O)N(C(C)=O)C(C)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H20N2O4/c1-4-14(20)18(13(3)19)12(2)8-6-5-7-11-17-15(21)9-10-16(17)22/h1,9-10,12H,5-8,11H2,2-3H3 |
| InChIKey | GEIZMLXLGJSQDI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide?
The IUPAC name of N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide (CID 154964280) is N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide.
What is the SMILES notation for N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide?
The canonical SMILES for N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide is C#CC(=O)N(C(C)=O)C(C)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide?
The InChIKey is GEIZMLXLGJSQDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4/c1-4-14(20)18(13(3)19)12(2)8-6-5-7-11-17-15(21)9-10-16(17)22/h1,9-10,12H,5-8,11H2,2-3H3.
What are the key properties of N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide?
N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide has a molecular weight of 304.35 g/mol, XLogP of 0.87, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-[7-(2,5-dioxopyrrol-1-yl)heptan-2-yl]prop-2-ynamide is sourced from PubChem (CID 154964280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).