C19H28F2N2O4 — CID 154966978
2,5-difluoro-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide (PubChem CID 154966978) has the molecular formula C19H28F2N2O4 and a molecular weight of 386.44 g/mol. Its IUPAC name is 2,5-difluoro-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide.
| Compound Name | 2,5-difluoro-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 154966978 |
| Molecular Formula | C19H28F2N2O4 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2,5-difluoro-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide |
| SMILES | C[C@@H](CNC(=O)CC(C)(C)COC(C)(C)O)NC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H28F2N2O4/c1-12(23-17(25)14-8-13(20)6-7-15(14)21)10-22-16(24)9-18(2,3)11-27-19(4,5)26/h6-8,12,26H,9-11H2,1-5H3,(H,22,24)(H,23,25)/t12-/m0/s1 |
| InChIKey | WBDRIQAHYGIUEB-LBPRGKRZSA-N |
| XLogP | 2.36 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|