C19H27ClF2N2O4 — CID 154967004
5-chloro-2,4-difluoro-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide (PubChem CID 154967004) has the molecular formula C19H27ClF2N2O4 and a molecular weight of 420.88 g/mol. Its IUPAC name is 5-chloro-2,4-difluoro-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide.
| Compound Name | 5-chloro-2,4-difluoro-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 154967004 |
| Molecular Formula | C19H27ClF2N2O4 |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 5-chloro-2,4-difluoro-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide |
| SMILES | C[C@@H](CNC(=O)CC(C)(C)COC(C)(C)O)NC(=O)c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C19H27ClF2N2O4/c1-11(24-17(26)12-6-13(20)15(22)7-14(12)21)9-23-16(25)8-18(2,3)10-28-19(4,5)27/h6-7,11,27H,8-10H2,1-5H3,(H,23,25)(H,24,26)/t11-/m0/s1 |
| InChIKey | LYZCJHCLPYCDMZ-NSHDSACASA-N |
| XLogP | 3.01 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|