C19H28F2N2O5 — CID 154967005
2,4-difluoro-5-hydroxy-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide (PubChem CID 154967005) has the molecular formula C19H28F2N2O5 and a molecular weight of 402.44 g/mol. Its IUPAC name is 2,4-difluoro-5-hydroxy-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide.
| Compound Name | 2,4-difluoro-5-hydroxy-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 154967005 |
| Molecular Formula | C19H28F2N2O5 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2,4-difluoro-5-hydroxy-N-[(2S)-1-[[4-(2-hydroxypropan-2-yloxy)-3,3-dimethylbutanoyl]amino]propan-2-yl]benzamide |
| SMILES | C[C@@H](CNC(=O)CC(C)(C)COC(C)(C)O)NC(=O)c1cc(O)c(F)cc1F |
| InChI | InChI=1S/C19H28F2N2O5/c1-11(23-17(26)12-6-15(24)14(21)7-13(12)20)9-22-16(25)8-18(2,3)10-28-19(4,5)27/h6-7,11,24,27H,8-10H2,1-5H3,(H,22,25)(H,23,26)/t11-/m0/s1 |
| InChIKey | AGGORQAUFGDRCE-NSHDSACASA-N |
| XLogP | 2.07 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|