C20H40N4 — CID 154968143
N,N-dimethyl-2-[3-(7-methyltridecan-7-yl)-1,2,4-triazol-1-yl]ethanamine (PubChem CID 154968143) has the molecular formula C20H40N4 and a molecular weight of 336.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-(7-methyltridecan-7-yl)-1,2,4-triazol-1-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[3-(7-methyltridecan-7-yl)-1,2,4-triazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 154968143 |
| Molecular Formula | C20H40N4 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.33 |
| IUPAC Name | N,N-dimethyl-2-[3-(7-methyltridecan-7-yl)-1,2,4-triazol-1-yl]ethanamine |
| SMILES | CCCCCCC(C)(CCCCCC)c1ncn(CCN(C)C)n1 |
| InChI | InChI=1S/C20H40N4/c1-6-8-10-12-14-20(3,15-13-11-9-7-2)19-21-18-24(22-19)17-16-23(4)5/h18H,6-17H2,1-5H3 |
| InChIKey | INURUGDLXUJGPK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|