C30H42FN3 — CID 154969838
(15E,19E)-19-ethyl-6-fluoro-14,15,17-trimethyl-2,21-dimethylidene-1,14,18-triazatricyclo[20.4.0.03,8]hexacosa-3(8),4,6,15,17,19-hexaene (PubChem CID 154969838) has the molecular formula C30H42FN3 and a molecular weight of 463.69 g/mol. Its IUPAC name is (15E,19E)-19-ethyl-6-fluoro-14,15,17-trimethyl-2,21-dimethylidene-1,14,18-triazatricyclo[20.4.0.03,8]hexacosa-3(8),4,6,15,17,19-hexaene.
| Compound Name | (15E,19E)-19-ethyl-6-fluoro-14,15,17-trimethyl-2,21-dimethylidene-1,14,18-triazatricyclo[20.4.0.03,8]hexacosa-3(8),4,6,15,17,19-hexaene |
|---|---|
| PubChem CID | 154969838 |
| Molecular Formula | C30H42FN3 |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.34 |
| IUPAC Name | (15E,19E)-19-ethyl-6-fluoro-14,15,17-trimethyl-2,21-dimethylidene-1,14,18-triazatricyclo[20.4.0.03,8]hexacosa-3(8),4,6,15,17,19-hexaene |
| SMILES | C=C1/C=C(CC)/N=C(C)\C=C(/C)N(C)CCCCCc2cc(F)ccc2C(=C)N2CCCCC12 |
| InChI | InChI=1S/C30H42FN3/c1-7-28-19-22(2)30-14-10-12-18-34(30)25(5)29-16-15-27(31)21-26(29)13-9-8-11-17-33(6)24(4)20-23(3)32-28/h15-16,19-21,30H,2,5,7-14,17-18H2,1,3-4,6H3/b24-20+,28-19+,32-23- |
| InChIKey | JJNBWXINLOXOQL-RDDLBOKISA-N |
| XLogP | 7.52 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |