C12H9NO — CID 15497341
(1S,1aS,7bS)-1-isocyanato-1a,7b-dihydro-1H-cyclopropa[a]naphthalene (PubChem CID 15497341) has the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. Its IUPAC name is (1S,1aS,7bS)-1-isocyanato-1a,7b-dihydro-1H-cyclopropa[a]naphthalene.
| Compound Name | (1S,1aS,7bS)-1-isocyanato-1a,7b-dihydro-1H-cyclopropa[a]naphthalene |
|---|---|
| PubChem CID | 15497341 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (1S,1aS,7bS)-1-isocyanato-1a,7b-dihydro-1H-cyclopropa[a]naphthalene |
| SMILES | O=C=N[C@H]1[C@H]2C=Cc3ccccc3[C@H]21 |
| InChI | InChI=1S/C12H9NO/c14-7-13-12-10-6-5-8-3-1-2-4-9(8)11(10)12/h1-6,10-12H/t10-,11+,12-/m0/s1 |
| InChIKey | ATOKRIRXQIFJLF-TUAOUCFPSA-N |
| XLogP | 2.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|