C16H16N2O2 — CID 101383602
(1S,10R,11R,16S)-12,14-dimethyl-12,14-diazatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 101383602) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (1S,10R,11R,16S)-12,14-dimethyl-12,14-diazatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,10R,11R,16S)-12,14-dimethyl-12,14-diazatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 101383602 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (1S,10R,11R,16S)-12,14-dimethyl-12,14-diazatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | CN1C(=O)[C@H]2[C@H]3c4ccccc4C=C[C@H]3[C@H]2N(C)C1=O |
| InChI | InChI=1S/C16H16N2O2/c1-17-14-11-8-7-9-5-3-4-6-10(9)12(11)13(14)15(19)18(2)16(17)20/h3-8,11-14H,1-2H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | KCJRJGRDJMGQNE-ZOBORPQBSA-N |
| XLogP | 1.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |