C5H3BrF6I2 — CID 15497387
1-bromo-1,1,2,2,5,5-hexafluoro-3,5-diiodopentane (PubChem CID 15497387) has the molecular formula C5H3BrF6I2 and a molecular weight of 510.78 g/mol. Its IUPAC name is 1-bromo-1,1,2,2,5,5-hexafluoro-3,5-diiodopentane.
| Compound Name | 1-bromo-1,1,2,2,5,5-hexafluoro-3,5-diiodopentane |
|---|---|
| PubChem CID | 15497387 |
| Molecular Formula | C5H3BrF6I2 |
| Molecular Weight | 510.78 g/mol |
| Exact Mass | 509.74 |
| IUPAC Name | 1-bromo-1,1,2,2,5,5-hexafluoro-3,5-diiodopentane |
| SMILES | FC(F)(I)CC(I)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C5H3BrF6I2/c6-5(11,12)4(9,10)2(13)1-3(7,8)14/h2H,1H2 |
| InChIKey | ALYXFGMFMGOBHX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.78 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|