C26H26FN3O2 — CID 154977250
1-(2H-chromen-4-yl)-4-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]butan-2-one (PubChem CID 154977250) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-(2H-chromen-4-yl)-4-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]butan-2-one.
| Compound Name | 1-(2H-chromen-4-yl)-4-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]butan-2-one |
|---|---|
| PubChem CID | 154977250 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-(2H-chromen-4-yl)-4-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]butan-2-one |
| SMILES | O=C(CCN1CCN(c2nccc3ccc(F)cc23)CC1)CC1=CCOc2ccccc21 |
| InChI | InChI=1S/C26H26FN3O2/c27-21-6-5-19-7-10-28-26(24(19)18-21)30-14-12-29(13-15-30)11-8-22(31)17-20-9-16-32-25-4-2-1-3-23(20)25/h1-7,9-10,18H,8,11-17H2 |
| InChIKey | RFBJTOZLKLHFPN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |