C33H54O6 — CID 154988548
1-O-(2-methyl-2-adamantyl) 6-O-(2-oxooxolan-3-yl) 2-tert-butyl-5-ethyl-2,3,3,4,4,5-hexamethylhexanedioate (PubChem CID 154988548) has the molecular formula C33H54O6 and a molecular weight of 546.79 g/mol. Its IUPAC name is 1-O-(2-methyl-2-adamantyl) 6-O-(2-oxooxolan-3-yl) 2-tert-butyl-5-ethyl-2,3,3,4,4,5-hexamethylhexanedioate.
| Compound Name | 1-O-(2-methyl-2-adamantyl) 6-O-(2-oxooxolan-3-yl) 2-tert-butyl-5-ethyl-2,3,3,4,4,5-hexamethylhexanedioate |
|---|---|
| PubChem CID | 154988548 |
| Molecular Formula | C33H54O6 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | 1-O-(2-methyl-2-adamantyl) 6-O-(2-oxooxolan-3-yl) 2-tert-butyl-5-ethyl-2,3,3,4,4,5-hexamethylhexanedioate |
| SMILES | CCC(C)(C(=O)OC1CCOC1=O)C(C)(C)C(C)(C)C(C)(C(=O)OC1(C)C2CC3CC(C2)CC1C3)C(C)(C)C |
| InChI | InChI=1S/C33H54O6/c1-12-31(9,26(35)38-24-13-14-37-25(24)34)29(5,6)30(7,8)33(11,28(2,3)4)27(36)39-32(10)22-16-20-15-21(18-22)19-23(32)17-20/h20-24H,12-19H2,1-11H3 |
| InChIKey | LSXNLAZJEBFTFA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|