C18H18N6O4 — CID 154995417
2-[formyl-[(9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl]amino]acetic acid (PubChem CID 154995417) has the molecular formula C18H18N6O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-[formyl-[(9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl]amino]acetic acid.
| Compound Name | 2-[formyl-[(9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl]amino]acetic acid |
|---|---|
| PubChem CID | 154995417 |
| Molecular Formula | C18H18N6O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[formyl-[(9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl]amino]acetic acid |
| SMILES | O=CN(CC(=O)O)c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C18H18N6O4/c25-11-23(10-16(26)27)15-5-4-13-17(21-15)24(12-6-8-22(13)9-12)18(28)20-14-3-1-2-7-19-14/h1-5,7,11-12H,6,8-10H2,(H,26,27)(H,19,20,28)/t12-/m0/s1 |
| InChIKey | DMZZFTXKZWZXAQ-LBPRGKRZSA-N |
| XLogP | 1.15 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|