C16H17ClN2O2 — CID 154997385
2-chloro-3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-N,5-dimethylbenzene-1,3-diamine (PubChem CID 154997385) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 2-chloro-3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-N,5-dimethylbenzene-1,3-diamine.
| Compound Name | 2-chloro-3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-N,5-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 154997385 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-chloro-3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-N,5-dimethylbenzene-1,3-diamine |
| SMILES | Cc1cc(N)c(Cl)c(N(C)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C16H17ClN2O2/c1-10-7-12(18)16(17)13(8-10)19(2)11-3-4-14-15(9-11)21-6-5-20-14/h3-4,7-9H,5-6,18H2,1-2H3 |
| InChIKey | LQOPPIBYUOGGSY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|