C13H19N5O4 — CID 154998037
(4-imidazol-1-yl-2-methyl-3,4-dioxo-1-piperazin-1-ylbutan-2-yl) carbamate (PubChem CID 154998037) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is (4-imidazol-1-yl-2-methyl-3,4-dioxo-1-piperazin-1-ylbutan-2-yl) carbamate.
| Compound Name | (4-imidazol-1-yl-2-methyl-3,4-dioxo-1-piperazin-1-ylbutan-2-yl) carbamate |
|---|---|
| PubChem CID | 154998037 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (4-imidazol-1-yl-2-methyl-3,4-dioxo-1-piperazin-1-ylbutan-2-yl) carbamate |
| SMILES | CC(CN1CCNCC1)(OC(N)=O)C(=O)C(=O)n1ccnc1 |
| InChI | InChI=1S/C13H19N5O4/c1-13(22-12(14)21,8-17-5-2-15-3-6-17)10(19)11(20)18-7-4-16-9-18/h4,7,9,15H,2-3,5-6,8H2,1H3,(H2,14,21) |
| InChIKey | FOEQOHHKFGOHLU-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|