C31H40N4O7 — CID 154998101
tert-butyl 4-(2-methoxyquinolin-3-yl)-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(E)-4-oxohex-2-enoxy]ethyl]imidazole-1-carboxylate (PubChem CID 154998101) has the molecular formula C31H40N4O7 and a molecular weight of 580.68 g/mol. Its IUPAC name is tert-butyl 4-(2-methoxyquinolin-3-yl)-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(E)-4-oxohex-2-enoxy]ethyl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-(2-methoxyquinolin-3-yl)-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(E)-4-oxohex-2-enoxy]ethyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 154998101 |
| Molecular Formula | C31H40N4O7 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | tert-butyl 4-(2-methoxyquinolin-3-yl)-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(E)-4-oxohex-2-enoxy]ethyl]imidazole-1-carboxylate |
| SMILES | CCC(=O)/C=C/COCC(NC(=O)OC(C)(C)C)c1nc(-c2cc3ccccc3nc2OC)cn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H40N4O7/c1-9-21(36)14-12-16-40-19-25(34-28(37)41-30(2,3)4)26-32-24(18-35(26)29(38)42-31(5,6)7)22-17-20-13-10-11-15-23(20)33-27(22)39-8/h10-15,17-18,25H,9,16,19H2,1-8H3,(H,34,37)/b14-12+ |
| InChIKey | CPCAQRZLZLYKCK-WYMLVPIESA-N |
| XLogP | 6.01 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|