C28H36N4O6 — CID 154998321
tert-butyl 4-(2-methoxyquinolin-3-yl)-2-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enoxyethyl]imidazole-1-carboxylate (PubChem CID 154998321) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is tert-butyl 4-(2-methoxyquinolin-3-yl)-2-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enoxyethyl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-(2-methoxyquinolin-3-yl)-2-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enoxyethyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 154998321 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | tert-butyl 4-(2-methoxyquinolin-3-yl)-2-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enoxyethyl]imidazole-1-carboxylate |
| SMILES | C=CCOC[C@H](NC(=O)OC(C)(C)C)c1nc(-c2cc3ccccc3nc2OC)cn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H36N4O6/c1-9-14-36-17-22(31-25(33)37-27(2,3)4)23-29-21(16-32(23)26(34)38-28(5,6)7)19-15-18-12-10-11-13-20(18)30-24(19)35-8/h9-13,15-16,22H,1,14,17H2,2-8H3,(H,31,33)/t22-/m0/s1 |
| InChIKey | NIIFXKVTFWQEJG-QFIPXVFZSA-N |
| XLogP | 5.66 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|