C24H28N4O6 — CID 154998301
4-(2-methoxyquinolin-3-yl)-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enoxyethyl]imidazole-1-carboxylic acid (PubChem CID 154998301) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is 4-(2-methoxyquinolin-3-yl)-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enoxyethyl]imidazole-1-carboxylic acid.
| Compound Name | 4-(2-methoxyquinolin-3-yl)-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enoxyethyl]imidazole-1-carboxylic acid |
|---|---|
| PubChem CID | 154998301 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 4-(2-methoxyquinolin-3-yl)-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enoxyethyl]imidazole-1-carboxylic acid |
| SMILES | C=CCOCC(NC(=O)OC(C)(C)C)c1nc(-c2cc3ccccc3nc2OC)cn1C(=O)O |
| InChI | InChI=1S/C24H28N4O6/c1-6-11-33-14-19(27-22(29)34-24(2,3)4)20-25-18(13-28(20)23(30)31)16-12-15-9-7-8-10-17(15)26-21(16)32-5/h6-10,12-13,19H,1,11,14H2,2-5H3,(H,27,29)(H,30,31) |
| InChIKey | PUBSOESNOLFERL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|