C15H22N2 — CID 155015059
2-methyl-5-(3-methylbut-1-en-2-yl)-N'-prop-1-en-2-ylcyclopenta-1,4-diene-1-carboximidamide (PubChem CID 155015059) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-methyl-5-(3-methylbut-1-en-2-yl)-N'-prop-1-en-2-ylcyclopenta-1,4-diene-1-carboximidamide.
| Compound Name | 2-methyl-5-(3-methylbut-1-en-2-yl)-N'-prop-1-en-2-ylcyclopenta-1,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 155015059 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-methyl-5-(3-methylbut-1-en-2-yl)-N'-prop-1-en-2-ylcyclopenta-1,4-diene-1-carboximidamide |
| SMILES | C=C(C)/N=C(\N)C1=C(C)CC=C1C(=C)C(C)C |
| InChI | InChI=1S/C15H22N2/c1-9(2)12(6)13-8-7-11(5)14(13)15(16)17-10(3)4/h8-9H,3,6-7H2,1-2,4-5H3,(H2,16,17) |
| InChIKey | LRFFIMOJJUAGDJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|