About 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine
3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine (PubChem CID 123487505) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine.
Analyze 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine?
The IUPAC name of 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine (CID 123487505) is 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine.
What is the SMILES notation for 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine?
The canonical SMILES for 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine is C=C1C=C(C)CC(C)C(N)=N1.
What is the InChIKey of 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine?
The InChIKey is YJMLUYPXYHCRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-6-4-7(2)9(10)11-8(3)5-6/h5,7H,3-4H2,1-2H3,(H2,10,11).
What are the key properties of 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine?
3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine has a molecular weight of 150.22 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-7-methylidene-3,4-dihydroazepin-2-amine is sourced from PubChem (CID 123487505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).