C39H39N3O3 — CID 155021501
N-[[3,5-bis(anilinomethyl)-2,4,6-tris(prop-2-ynoxymethyl)phenyl]methyl]aniline (PubChem CID 155021501) has the molecular formula C39H39N3O3 and a molecular weight of 597.76 g/mol. Its IUPAC name is N-[[3,5-bis(anilinomethyl)-2,4,6-tris(prop-2-ynoxymethyl)phenyl]methyl]aniline.
| Compound Name | N-[[3,5-bis(anilinomethyl)-2,4,6-tris(prop-2-ynoxymethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 155021501 |
| Molecular Formula | C39H39N3O3 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | N-[[3,5-bis(anilinomethyl)-2,4,6-tris(prop-2-ynoxymethyl)phenyl]methyl]aniline |
| SMILES | C#CCOCc1c(CNc2ccccc2)c(COCC#C)c(CNc2ccccc2)c(COCC#C)c1CNc1ccccc1 |
| InChI | InChI=1S/C39H39N3O3/c1-4-22-43-28-37-34(25-40-31-16-10-7-11-17-31)38(29-44-23-5-2)36(27-42-33-20-14-9-15-21-33)39(30-45-24-6-3)35(37)26-41-32-18-12-8-13-19-32/h1-3,7-21,40-42H,22-30H2 |
| InChIKey | RYNSEBFVSSYFOU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|