C17H34N2O6 — CID 155027212
2-methyl-4-(methylamino)-8-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxan-2-yl]methylamino]octan-3-one (PubChem CID 155027212) has the molecular formula C17H34N2O6 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-methyl-4-(methylamino)-8-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxan-2-yl]methylamino]octan-3-one.
| Compound Name | 2-methyl-4-(methylamino)-8-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxan-2-yl]methylamino]octan-3-one |
|---|---|
| PubChem CID | 155027212 |
| Molecular Formula | C17H34N2O6 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-methyl-4-(methylamino)-8-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxan-2-yl]methylamino]octan-3-one |
| SMILES | CNC(CCCCNCC1(O)OCC(CO)C(O)C1O)C(=O)C(C)C |
| InChI | InChI=1S/C17H34N2O6/c1-11(2)14(21)13(18-3)6-4-5-7-19-10-17(24)16(23)15(22)12(8-20)9-25-17/h11-13,15-16,18-20,22-24H,4-10H2,1-3H3 |
| InChIKey | DVEMIZOSBNBRMV-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|