C15H28N2O6 — CID 118489125
methyl 2-(methylamino)-6-[(2,6,7-trihydroxy-3-oxabicyclo[3.2.0]heptan-2-yl)methylamino]hexanoate (PubChem CID 118489125) has the molecular formula C15H28N2O6 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 2-(methylamino)-6-[(2,6,7-trihydroxy-3-oxabicyclo[3.2.0]heptan-2-yl)methylamino]hexanoate.
| Compound Name | methyl 2-(methylamino)-6-[(2,6,7-trihydroxy-3-oxabicyclo[3.2.0]heptan-2-yl)methylamino]hexanoate |
|---|---|
| PubChem CID | 118489125 |
| Molecular Formula | C15H28N2O6 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | methyl 2-(methylamino)-6-[(2,6,7-trihydroxy-3-oxabicyclo[3.2.0]heptan-2-yl)methylamino]hexanoate |
| SMILES | CNC(CCCCNCC1(O)OCC2C(O)C(O)C21)C(=O)OC |
| InChI | InChI=1S/C15H28N2O6/c1-16-10(14(20)22-2)5-3-4-6-17-8-15(21)11-9(7-23-15)12(18)13(11)19/h9-13,16-19,21H,3-8H2,1-2H3 |
| InChIKey | DKVIQBMLPYOIIM-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|