C17H16N4O4S2 — CID 155027789
2-[4-cyano-N-(furan-2-ylmethyl)anilino]-4-[hydroxy-(sulfinoamino)methyl]-5-methyl-1,3-thiazole (PubChem CID 155027789) has the molecular formula C17H16N4O4S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[4-cyano-N-(furan-2-ylmethyl)anilino]-4-[hydroxy-(sulfinoamino)methyl]-5-methyl-1,3-thiazole.
| Compound Name | 2-[4-cyano-N-(furan-2-ylmethyl)anilino]-4-[hydroxy-(sulfinoamino)methyl]-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 155027789 |
| Molecular Formula | C17H16N4O4S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-[4-cyano-N-(furan-2-ylmethyl)anilino]-4-[hydroxy-(sulfinoamino)methyl]-5-methyl-1,3-thiazole |
| SMILES | Cc1sc(N(Cc2ccco2)c2ccc(C#N)cc2)nc1C(O)NS(=O)O |
| InChI | InChI=1S/C17H16N4O4S2/c1-11-15(16(22)20-27(23)24)19-17(26-11)21(10-14-3-2-8-25-14)13-6-4-12(9-18)5-7-13/h2-8,16,20,22H,10H2,1H3,(H,23,24) |
| InChIKey | GLGHNNHXLPGXHH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|