C14H14N2O3S — CID 155031248
4-methyl-2-(6-oxo-2-sulfanylidenepiperidin-3-yl)-3a,4-dihydroisoindole-1,3-dione (PubChem CID 155031248) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-methyl-2-(6-oxo-2-sulfanylidenepiperidin-3-yl)-3a,4-dihydroisoindole-1,3-dione.
| Compound Name | 4-methyl-2-(6-oxo-2-sulfanylidenepiperidin-3-yl)-3a,4-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 155031248 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-methyl-2-(6-oxo-2-sulfanylidenepiperidin-3-yl)-3a,4-dihydroisoindole-1,3-dione |
| SMILES | CC1C=CC=C2C(=O)N(C3CCC(=O)NC3=S)C(=O)C21 |
| InChI | InChI=1S/C14H14N2O3S/c1-7-3-2-4-8-11(7)14(19)16(13(8)18)9-5-6-10(17)15-12(9)20/h2-4,7,9,11H,5-6H2,1H3,(H,15,17,20) |
| InChIKey | NPTHRNOQLQCXSG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|