C20H27N3O5 — CID 170109322
2-(2,6-dioxopiperidin-3-yl)-7-(6-hydroxyhexylamino)-4-methyl-3a,4-dihydroisoindole-1,3-dione (PubChem CID 170109322) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-7-(6-hydroxyhexylamino)-4-methyl-3a,4-dihydroisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-7-(6-hydroxyhexylamino)-4-methyl-3a,4-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 170109322 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-7-(6-hydroxyhexylamino)-4-methyl-3a,4-dihydroisoindole-1,3-dione |
| SMILES | CC1C=CC(NCCCCCCO)=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C21 |
| InChI | InChI=1S/C20H27N3O5/c1-12-6-7-13(21-10-4-2-3-5-11-24)17-16(12)19(27)23(20(17)28)14-8-9-15(25)22-18(14)26/h6-7,12,14,16,21,24H,2-5,8-11H2,1H3,(H,22,25,26) |
| InChIKey | COPIUZPTFQUIEB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|