C21H24FN3O5 — CID 170000243
2-(2,6-dioxopiperidin-3-yl)-6-fluoro-4-(7-oxooctylamino)isoindole-1,3-dione (PubChem CID 170000243) has the molecular formula C21H24FN3O5 and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-6-fluoro-4-(7-oxooctylamino)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-6-fluoro-4-(7-oxooctylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 170000243 |
| Molecular Formula | C21H24FN3O5 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-6-fluoro-4-(7-oxooctylamino)isoindole-1,3-dione |
| SMILES | CC(=O)CCCCCCNc1cc(F)cc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H24FN3O5/c1-12(26)6-4-2-3-5-9-23-15-11-13(22)10-14-18(15)21(30)25(20(14)29)16-7-8-17(27)24-19(16)28/h10-11,16,23H,2-9H2,1H3,(H,24,27,28) |
| InChIKey | FJHFACDICASVGA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|