C16H16N2O3S — CID 155331354
7-methyl-2-(6-oxo-2-sulfanylidenepiperidin-3-yl)-4,8-dihydrocyclohepta[c]pyridine-1,3-dione (PubChem CID 155331354) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 7-methyl-2-(6-oxo-2-sulfanylidenepiperidin-3-yl)-4,8-dihydrocyclohepta[c]pyridine-1,3-dione.
| Compound Name | 7-methyl-2-(6-oxo-2-sulfanylidenepiperidin-3-yl)-4,8-dihydrocyclohepta[c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 155331354 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 7-methyl-2-(6-oxo-2-sulfanylidenepiperidin-3-yl)-4,8-dihydrocyclohepta[c]pyridine-1,3-dione |
| SMILES | CC1=CC=C2CC(=O)N(C3CCC(=O)NC3=S)C(=O)C2=CC1 |
| InChI | InChI=1S/C16H16N2O3S/c1-9-2-4-10-8-14(20)18(16(21)11(10)5-3-9)12-6-7-13(19)17-15(12)22/h2,4-5,12H,3,6-8H2,1H3,(H,17,19,22) |
| InChIKey | CGNFVTHVJFOFBU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|