C18H25N3O3 — CID 67472020
3-[(5Z,7Z)-2-butyl-8-methyl-10-oxo-4,9-dihydro-1,3-diazecin-1-yl]piperidine-2,6-dione (PubChem CID 67472020) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-[(5Z,7Z)-2-butyl-8-methyl-10-oxo-4,9-dihydro-1,3-diazecin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[(5Z,7Z)-2-butyl-8-methyl-10-oxo-4,9-dihydro-1,3-diazecin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 67472020 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 3-[(5Z,7Z)-2-butyl-8-methyl-10-oxo-4,9-dihydro-1,3-diazecin-1-yl]piperidine-2,6-dione |
| SMILES | CCCC/C1=N/C/C=C\C=C(\C)CC(=O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H25N3O3/c1-3-4-8-15-19-11-6-5-7-13(2)12-17(23)21(15)14-9-10-16(22)20-18(14)24/h5-7,14H,3-4,8-12H2,1-2H3,(H,20,22,24)/b6-5-,13-7-,19-15- |
| InChIKey | HZSOMAIQMPDGDV-YWXXNKLFSA-N |
| XLogP | 2.12 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|